CAS 101-89-3|ci 37210
| Common Name | ci 37210 | ||
|---|---|---|---|
| CAS Number | 101-89-3 | Molecular Weight | 334.350 |
| Density | 1.3798 (rough estimate) | Boiling Point | / |
| Molecular Formula | C14H14N4O4S | Melting Point | / |
| MSDS | ChineseUSA | Flash Point | / |
| Symbol | GHS08 | Signal Word | Danger |
Names
| Name | hydrogen sulfate,2-methyl-4-[(2-methylphenyl)diazenyl]benzenediazonium |
|---|---|
| Synonym | More Synonyms |
Chemical & Physical Properties
| Density | 1.3798 (rough estimate) |
|---|---|
| Molecular Formula | C14H14N4O4S |
| Molecular Weight | 334.350 |
| Exact Mass | 334.073578 |
| PSA | 138.68000 |
| LogP | 5.28878 |
| Index of Refraction | 1.6270 (estimate) |
| InChIKey | PPTXFSQSISUDAU-UHFFFAOYSA-M |
| SMILES | Cc1ccccc1N=Nc1ccc([N+]#N)c(C)c1.O=S(=O)([O-])O |
| Storage condition | −20°C |
Safety Information
| Symbol | GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H350 |
| Precautionary Statements | P201-P308 + P313 |
| Personal Protective Equipment | Eyeshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | T: Toxic; |
| Risk Phrases | R45 |
| Safety Phrases | 53-45-36/37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
Articles2
More Articles| Human stefin B role in cell's response to misfolded proteins and autophagy. PLoS ONE 9(7) , e102500, (2014) Alternative functions, apart from cathepsins inhibition, are being discovered for stefin B. Here, we investigate its role in vesicular trafficking and autophagy. Astrocytes isolated from stefin B knoc... | |
| Differences in copper bioaccumulation and biological responses in three Mytilus species. Aquat. Toxicol. 160 , 1-12, (2015) Mytilus species are important organisms in marine systems being highly abundant and widely distributed along the coast of Europe and worldwide. They are typically used in biological effects studies an... |
Synonyms
| 2-Methyl-4-([2-methylphenyl]azo)benzenediazonium salt |
| EINECS 202-985-4 |
| Fast Garnet GBC |
| 2-Methyl-4-[(E)-(2-methylphenyl)diazenyl]benzenediazonium hydrogen sulfate |
| Fast Garnet GBC sulfate salt |
| Azoic Diazo No. 4 |
| Benzenediazonium,2-methyl-4-((2-methylphenyl)azo)-,sulfate (1:1) |
| Fast Garnet GBC Salt |
| MFCD00011883 |
