Introduction：Basic information about CAS 50651-39-3|Acetamide,N-(4-methoxy-3-nitrophenyl)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Acetamide,N-(4-methoxy-3-nitrophenyl)- |
|---|
| CAS Number | 50651-39-3 | Molecular Weight | 210.18700 |
|---|
| Density | 1.327g/cm3 | Boiling Point | 424.1ºC at 760 mmHg |
|---|
| Molecular Formula | C9H10N2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 210.3ºC |
|---|
Names
| Name | n-(4-methoxy-3-nitrophenyl)acetamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.327g/cm3 |
|---|
| Boiling Point | 424.1ºC at 760 mmHg |
|---|
| Molecular Formula | C9H10N2O4 |
|---|
| Molecular Weight | 210.18700 |
|---|
| Flash Point | 210.3ºC |
|---|
| Exact Mass | 210.06400 |
|---|
| PSA | 84.15000 |
|---|
| LogP | 2.15800 |
|---|
| Index of Refraction | 1.594 |
|---|
| InChIKey | MYIUWCZXTNZSMN-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(NC(C)=O)cc1[N+](=O)[O-] |
|---|
Synonyms
| 2-nitro-4-acetylamino-anisole |
| Essigsaeure-(4-methoxy-3-nitro-anilid) |
| 4-acetamido-2-nitro-anisole |
| 4-Methoxy-3-nitroacetanilide |
| 2-Nitro-4-acetamino-phenol-methylaether |
| 4-Acetylamino-2-nitroanisole |
| 3'-Nitro-p-acetanisidide |
| acetic acid-(4-methoxy-3-nitro-anilide) |
| Acetamide,N-(4-methoxy-3-nitrophenyl) |
