Introduction：Basic information about CAS 81-05-0|Dahl's Acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Dahl's Acid |
|---|
| CAS Number | 81-05-0 | Molecular Weight | 223.248 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C10H9NO3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 6-Aminonaphthalene-1-sulfonic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Molecular Formula | C10H9NO3S |
|---|
| Molecular Weight | 223.248 |
|---|
| Exact Mass | 223.030319 |
|---|
| PSA | 88.77000 |
|---|
| LogP | 0.42 |
|---|
| Index of Refraction | 1.713 |
|---|
| InChIKey | YUNBHHWDQDGWHC-UHFFFAOYSA-N |
|---|
| SMILES | Nc1ccc2c(S(=O)(=O)O)cccc2c1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| RIDADR | 1759 |
|---|
| Packaging Group | III |
|---|
| Hazard Class | 8 |
|---|
| HS Code | 29269095 |
|---|
Customs
Synonyms
| MFCD00035724 |
| Dahl's Acid |
| 6-Amino-1-naphthalenesulfonic acid |
| 6-Aminonaphthalene-1-sulfonic acid |
| 1-Naphthalenesulfonic acid, 6-amino- |
| EINECS 201-318-4 |
| 2-Amino-5-naphthalenesulfonic acid |
