Introduction：Basic information about CAS 6665-00-5|D-Galactose,6-(dihydrogen phosphate), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | D-Galactose,6-(dihydrogen phosphate) |
|---|
| CAS Number | 6665-00-5 | Molecular Weight | 260.13600 |
|---|
| Density | 1.832g/cm3 | Boiling Point | 667.8ºC at 760 mmHg |
|---|
| Molecular Formula | C6H13O9P | Melting Point | / |
|---|
| MSDS | / | Flash Point | 357.7ºC |
|---|
Names
| Name | aldehydo-D-galactose 6-phosphate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.832g/cm3 |
|---|
| Boiling Point | 667.8ºC at 760 mmHg |
|---|
| Molecular Formula | C6H13O9P |
|---|
| Molecular Weight | 260.13600 |
|---|
| Flash Point | 357.7ºC |
|---|
| Exact Mass | 260.03000 |
|---|
| PSA | 166.72000 |
|---|
| Index of Refraction | 1.586 |
|---|
| InChIKey | KSBHKOHMSASBHL-SHQHISBTSA-L |
|---|
| SMILES | O=CC(O)C(O)C(O)C(O)COP(=O)([O-])[O-].[Li+].[Li+] |
|---|
Synonyms
| D-Galactose-6-phosphate |
| Galactose-6-phosphoric acid |
| galactose-6-phosphate |
| D-glucose 6-phosphate |
| D-Galactose 6-phosphoric acid |
