Introduction：Basic information about CAS 690632-70-3|2-bromo-1-(5-bromo-2,3-dihydro-1-benzofuran-7-yl)ethanone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-bromo-1-(5-bromo-2,3-dihydro-1-benzofuran-7-yl)ethanone |
|---|
| CAS Number | 690632-70-3 | Molecular Weight | 319.97700 |
|---|
| Density | 1.877g/cm3 | Boiling Point | 403.4ºC at 760 mmHg |
|---|
| Molecular Formula | C10H8Br2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 2-bromo-1-(5-bromo-2,3-dihydro-1-benzofuran-7-yl)ethanone |
|---|
Chemical & Physical Properties
| Density | 1.877g/cm3 |
|---|
| Boiling Point | 403.4ºC at 760 mmHg |
|---|
| Molecular Formula | C10H8Br2O2 |
|---|
| Molecular Weight | 319.97700 |
|---|
| Exact Mass | 317.88900 |
|---|
| PSA | 26.30000 |
|---|
| LogP | 2.96160 |
|---|
| Index of Refraction | 1.632 |
|---|
| InChIKey | NPGVDFRSCHXENE-UHFFFAOYSA-N |
|---|
| SMILES | O=C(CBr)c1cc(Br)cc2c1OCC2 |
|---|
