Introduction：Basic information about CAS 171338-27-5|(2R,3S)-2-[(1R)-1-[3,5-bis(Trifluoromethyl)phenyl)ethoxy]-3-(4-fluorophenyl)m, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (2R,3S)-2-[(1R)-1-[3,5-bis(Trifluoromethyl)phenyl)ethoxy]-3-(4-fluorophenyl)morpholine |
|---|
| CAS Number | 171338-27-5 | Molecular Weight | 437.35100 |
|---|
| Density | 1.375 g/cm3 | Boiling Point | 387.856ºC at 760 mmHg |
|---|
| Molecular Formula | C20H18F7NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 188.369ºC |
|---|
Names
| Name | (2R,3S)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-(4-fluorophenyl)morpholine |
|---|
Chemical & Physical Properties
| Density | 1.375 g/cm3 |
|---|
| Boiling Point | 387.856ºC at 760 mmHg |
|---|
| Molecular Formula | C20H18F7NO2 |
|---|
| Molecular Weight | 437.35100 |
|---|
| Flash Point | 188.369ºC |
|---|
| Exact Mass | 437.12300 |
|---|
| PSA | 30.49000 |
|---|
| LogP | 5.99300 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.505 |
|---|
| InChIKey | AFBDSAJOMZYQAI-CNOZUTPLSA-N |
|---|
| SMILES | CC(OC1OCCNC1c1ccc(F)cc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
|---|
