Introduction：Basic information about CAS 27580-14-9|fast red salt itr, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | fast red salt itr |
|---|
| CAS Number | 27580-14-9 | Molecular Weight | 305.78100 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C11H16ClN3O3S | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
| Symbol |
GHS07, GHS08 | Signal Word | Warning |
|---|
Names
| Name | 5-(diethylsulfamoyl)-2-methoxybenzenediazonium |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C11H16ClN3O3S |
|---|
| Molecular Weight | 305.78100 |
|---|
| Exact Mass | 305.06000 |
|---|
| PSA | 83.14000 |
|---|
| LogP | 0.29508 |
|---|
| InChIKey | QPRGGJBGRUMFBU-UHFFFAOYSA-N |
|---|
| SMILES | CCN(CC)S(=O)(=O)c1ccc(OC)c([N+]#N)c1 |
|---|
| Storage condition | −20°C |
|---|
Safety Information
| Symbol |
GHS07, GHS08 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H302-H312-H332-H351 |
|---|
| Precautionary Statements | P280 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xn |
|---|
| Risk Phrases | 20/21/22-40 |
|---|
| Safety Phrases | 22-36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| MFCD00011889 |
| 5-Diethylaminosulfonyl-2-methoxybenzenediazonium chloride hemi(zinc chloride) salt |
| EINECS 248-543-4 |
| CTK4F9918 |
| Fast Red ITR Salt |
| F1375_SIGMA |
| AC1Q6UI8 |
| Benzenediazonium,5-((diethylamino)sulfonyl)-2-methoxy |
| AC1L52EG |
