Introduction：Basic information about CAS 5438-22-2|Butanedioic acid,2-(diphenylmethylene)-, 1-ethyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Butanedioic acid,2-(diphenylmethylene)-, 1-ethyl ester |
|---|
| CAS Number | 5438-22-2 | Molecular Weight | 310.34400 |
|---|
| Density | 1.189g/cm3 | Boiling Point | 459.7ºC at 760mmHg |
|---|
| Molecular Formula | C19H18O4 | Melting Point | 128-130ºC |
|---|
| MSDS | / | Flash Point | 162.9ºC |
|---|
Names
| Name | 3-ethoxycarbonyl-4,4-diphenylbut-3-enoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.189g/cm3 |
|---|
| Boiling Point | 459.7ºC at 760mmHg |
|---|
| Melting Point | 128-130ºC |
|---|
| Molecular Formula | C19H18O4 |
|---|
| Molecular Weight | 310.34400 |
|---|
| Flash Point | 162.9ºC |
|---|
| Exact Mass | 310.12100 |
|---|
| PSA | 63.60000 |
|---|
| LogP | 3.52630 |
|---|
| Index of Refraction | 1.58 |
|---|
| InChIKey | DLPKPLGMFNWETI-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)C(CC(=O)O)=C(c1ccccc1)c1ccccc1 |
|---|
Safety Information
Customs
| HS Code | 2918990090 |
|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 3-(ethoxycarbonyl)-4,4-diphenyl-3-butenoic acid |
| 1-ethyl 4-hydrogen 2-(diphenylmethylene)succinate |
| 3-(ethoxycarbonyl)-4,4-diphenylbut-3-enoic acid |
| benzhydrylidene-succinic acid-1-ethyl ester |
| ethoxycarbonyldiphenylbutenoicacid |
| Benzhydryliden-bernsteinsaeure-1-aethylester |
