Introduction:Basic information about CAS 50305-28-7|ZL-Trp-OSu, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | ZL-Trp-OSu |
|---|
| CAS Number | 50305-28-7 | Molecular Weight | 435.429 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C23H21N3O6 | Melting Point | 64 °C |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | (2,5-dioxopyrrolidin-1-yl) (2S)-3-(1H-indol-3-yl)-2-(phenylmethoxycarbonylamino)propanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Melting Point | 64 °C |
|---|
| Molecular Formula | C23H21N3O6 |
|---|
| Molecular Weight | 435.429 |
|---|
| Exact Mass | 435.143036 |
|---|
| PSA | 117.80000 |
|---|
| LogP | 2.05 |
|---|
| Index of Refraction | 1.669 |
|---|
| InChIKey | PLMKYGHASWACNG-IBGZPJMESA-N |
|---|
| SMILES | O=C(NC(Cc1c[nH]c2ccccc12)C(=O)ON1C(=O)CCC1=O)OCc1ccccc1 |
|---|
| Storage condition | -15°C |
|---|
Safety Information
Synonyms
| CBZ-(L)-tryptophan N-hydroxysuccinimide ester |
| Z-Trp-OSu |
| 2,5-dioxopyrrolidin-1-yl (S)-2-(benzyloxycarbonylamino)-3-(1H-indol-3-yl)propanoate |
| L-Tryptophan, N-[(phenylmethoxy)carbonyl]-, 2,5-dioxo-1-pyrrolidinyl ester |
| 2,5-Dioxo-1-pyrrolidinyl N-[(benzyloxy)carbonyl]-L-tryptophanate |
| Z-L-Trp-OSu |
| 2,5-dioxopyrrolidin-1-yl N-[(benzyloxy)carbonyl]-L-tryptophanate |
| N-[(Phenylmethoxy)Carbonyl]-L-Tryptophan 2,5-Dioxo-1-Pyrrolidinyl Ester |
| AmbotzZAA1253 |
| Cbz-L-Tryptophan-OSu |
| Z-Trp-ONSu |