Introduction：Basic information about CAS 1726-23-4|Tributyl Trimellitate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Tributyl Trimellitate |
|---|
| CAS Number | 1726-23-4 | Molecular Weight | 378.45900 |
|---|
| Density | 1.076g/cm3 | Boiling Point | 451.6ºC at 760mmHg |
|---|
| Molecular Formula | C21H30O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 192.8ºC |
|---|
Names
| Name | tributyl benzene-1,2,4-tricarboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.076g/cm3 |
|---|
| Boiling Point | 451.6ºC at 760mmHg |
|---|
| Molecular Formula | C21H30O6 |
|---|
| Molecular Weight | 378.45900 |
|---|
| Flash Point | 192.8ºC |
|---|
| Exact Mass | 378.20400 |
|---|
| PSA | 78.90000 |
|---|
| LogP | 4.55730 |
|---|
| Vapour Pressure | 2.39E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.499 |
|---|
| InChIKey | RJIFVNWOLLIBJV-UHFFFAOYSA-N |
|---|
| SMILES | CCCCOC(=O)c1ccc(C(=O)OCCCC)c(C(=O)OCCCC)c1 |
|---|
Safety Information
Customs
| HS Code | 2917399090 |
|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| Trimellitic Acid Tributyl Ester |
| Trimellitic acid tri-n-butyl ester |
| Trimellitsaeure-tributylester |
| EINECS 217-038-0 |
| tri-n-butyl benzene-1,2,4-tricarboxylate |
| 1,2,4-Benzenetricarboxylic Acid Tributyl Ester |
| Tributyl TriMellitate |
