Introduction:Basic information about CAS 249937-00-6|methyl 3-(2-morpholin-4-ylethoxy)benzoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | methyl 3-(2-morpholin-4-ylethoxy)benzoate |
|---|
| CAS Number | 249937-00-6 | Molecular Weight | 265.30500 |
|---|
| Density | 1.141g/cm3 | Boiling Point | 396.9ºC at 760 mmHg |
|---|
| Molecular Formula | C14H19NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 193.9ºC |
|---|
Names
| Name | methyl 3-(2-morpholin-4-ylethoxy)benzoate |
|---|
Chemical & Physical Properties
| Density | 1.141g/cm3 |
|---|
| Boiling Point | 396.9ºC at 760 mmHg |
|---|
| Molecular Formula | C14H19NO4 |
|---|
| Molecular Weight | 265.30500 |
|---|
| Flash Point | 193.9ºC |
|---|
| Exact Mass | 265.13100 |
|---|
| PSA | 48.00000 |
|---|
| LogP | 1.12210 |
|---|
| Vapour Pressure | 1.65E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.522 |
|---|
| InChIKey | VOYSHDFODOJUMP-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1cccc(OCCN2CCOCC2)c1 |
|---|