Introduction：Basic information about CAS 27462-91-5|5-(3-methoxyphenyl)cyclohexane-1,3-dione, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-(3-methoxyphenyl)cyclohexane-1,3-dione |
|---|
| CAS Number | 27462-91-5 | Molecular Weight | 218.24800 |
|---|
| Density | 1.163g/cm3 | Boiling Point | 391ºC at 760mmHg |
|---|
| Molecular Formula | C13H14O3 | Melting Point | / |
|---|
| MSDS | USA | Flash Point | 175.8ºC |
|---|
Names
| Name | 5-(3-methoxyphenyl)cyclohexane-1,3-dione |
|---|
Chemical & Physical Properties
| Density | 1.163g/cm3 |
|---|
| Boiling Point | 391ºC at 760mmHg |
|---|
| Molecular Formula | C13H14O3 |
|---|
| Molecular Weight | 218.24800 |
|---|
| Flash Point | 175.8ºC |
|---|
| Exact Mass | 218.09400 |
|---|
| PSA | 43.37000 |
|---|
| LogP | 2.10090 |
|---|
| Vapour Pressure | 2.54E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.542 |
|---|
| InChIKey | AQUXWSRUHWNKNU-UHFFFAOYSA-N |
|---|
| SMILES | COc1cccc(C2CC(=O)CC(=O)C2)c1 |
|---|
