Introduction：Basic information about CAS 3220-60-8|Methyl sterculate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methyl sterculate |
|---|
| CAS Number | 3220-60-8 | Molecular Weight | 308.499 |
|---|
| Density | 0.9±0.1 g/cm3 | Boiling Point | 384.8±21.0 °C at 760 mmHg |
|---|
| Molecular Formula | C20H36O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 98.8±20.4 °C |
|---|
Names
| Name | methyl 8-(2-octylcycloprop-1-enyl)octanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.9±0.1 g/cm3 |
|---|
| Boiling Point | 384.8±21.0 °C at 760 mmHg |
|---|
| Molecular Formula | C20H36O2 |
|---|
| Molecular Weight | 308.499 |
|---|
| Flash Point | 98.8±20.4 °C |
|---|
| Exact Mass | 308.271515 |
|---|
| PSA | 26.30000 |
|---|
| LogP | 8.18 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.472 |
|---|
| InChIKey | CMRNMZJAUFXOQF-UHFFFAOYSA-N |
|---|
| SMILES | CCCCCCCCC1=C(CCCCCCCC(=O)OC)C1 |
|---|
Safety Information
Customs
| HS Code | 2916209090 |
|---|
| Summary | 2916209090 other cyclanic, cyclenic or cyclotherpenic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 1-Cyclopropene-1-octanoic acid, 2-octyl-, methyl ester |
| 2-Octyl-1-cyclopropene-1-octanoic acid methyl ester |
| Methyl 2-octylcyclopropene-1-octanoate |
| methyl ester of sterculic acid |
| Sterculicsaeure-methylester |
| 8-(2-octyl-cycloprop-1-enyl)-octanoic acid methyl ester |
| STERCULICACIDMETHYLESTER |
| Methyl sterculate |
| 8-(2-Octyl-1-cyclopropen-1-yl)octanoic acid methyl ester |
| 8-(2-octylcycloprop-1-en-1-yl)nonanoate |
| 8-(2-Octyl-cycloprop-1-enyl)-octansaeure-methylester |
| Methyl 8-(2-octyl-1-cyclopropen-1-yl)octanoate |
