Introduction:Basic information about CAS 4831-21-4|2-(4-bromoanilino)-1-phenylethanone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(4-bromoanilino)-1-phenylethanone |
|---|
| CAS Number | 4831-21-4 | Molecular Weight | 290.15500 |
|---|
| Density | 1.443g/cm3 | Boiling Point | 438.6ºC at 760 mmHg |
|---|
| Molecular Formula | C14H12BrNO | Melting Point | 158-160ºC |
|---|
| MSDS | / | Flash Point | 219.1ºC |
|---|
Names
| Name | 2-(4-bromoanilino)-1-phenylethanone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.443g/cm3 |
|---|
| Boiling Point | 438.6ºC at 760 mmHg |
|---|
| Melting Point | 158-160ºC |
|---|
| Molecular Formula | C14H12BrNO |
|---|
| Molecular Weight | 290.15500 |
|---|
| Flash Point | 219.1ºC |
|---|
| Exact Mass | 289.01000 |
|---|
| PSA | 29.10000 |
|---|
| LogP | 3.81690 |
|---|
| Index of Refraction | 1.648 |
|---|
| InChIKey | LPKCHKLRDTZTHS-UHFFFAOYSA-N |
|---|
| SMILES | O=C(CNc1ccc(Br)cc1)c1ccccc1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2922399090 |
|---|
Customs
| HS Code | 2922399090 |
|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 2-(4-bromoanilino)-1-phenyl-1-ethanone |
| 2-(2-CHLOROPHENOXY)PROPYLAMINE |
| ethanone,2-[(4-bromophenyl)amino]-1-phenyl |
| Phenacyl-N-(p-bromanilin) |
| Phenacyl-p-brom-anilin |
| N-Phenacyl-4-brom-anilin |
| 2-(4-bromophenylamino)-1-phenylethanone |
| 1-phenyl-2-((4-bromophenyl)amino)ethanone |
| bromoanilinophenylethanone |