Introduction：Basic information about CAS 662-22-6|2,2-bis(trifluoromethyl)-2-hydroxyacetic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,2-bis(trifluoromethyl)-2-hydroxyacetic acid |
|---|
| CAS Number | 662-22-6 | Molecular Weight | 212.04700 |
|---|
| Density | 1,183 g/cm3 | Boiling Point | 153-156°C |
|---|
| Molecular Formula | C4H2F6O3 | Melting Point | 30°C |
|---|
| MSDS | ChineseUSA | Flash Point | 153-156°C |
|---|
Names
| Name | 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1,183 g/cm3 |
|---|
| Boiling Point | 153-156°C |
|---|
| Melting Point | 30°C |
|---|
| Molecular Formula | C4H2F6O3 |
|---|
| Molecular Weight | 212.04700 |
|---|
| Flash Point | 153-156°C |
|---|
| Exact Mass | 211.99100 |
|---|
| PSA | 57.53000 |
|---|
| LogP | 0.92670 |
|---|
| Index of Refraction | 1.332 |
|---|
| InChIKey | CMQUGOHGJUTDGZ-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)C(O)(C(F)(F)F)C(F)(F)F |
|---|
Safety Information
| Hazard Codes | C,Xi |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | S26-S36/37/39-S45 |
|---|
| RIDADR | 3265 |
|---|
| Packaging Group | III |
|---|
| Hazard Class | 8 |
|---|
| HS Code | 2918199090 |
|---|
Customs
| HS Code | 2918199090 |
|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| 2,2-bis-trifluoromethyl 2-hydroxyacetic acid |
| 3,3,3-trifluoro-2-hydroxy-2-trifluoromethylpropionic acid |
| PC1253T |
| 3,3,3-Trifluor-2-hydroxy-2-trifluormethyl-propionsaeure |
| 2-hydroxy-2-trifluoromethyl-3,3,3-trifluoropropanoic acid |
| hexafluoro-2-hydroxyisobutyric acid |
| MFCD00190631 |
