Introduction：Basic information about CAS 467-98-1|thebainone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | thebainone |
|---|
| CAS Number | 467-98-1 | Molecular Weight | 299.36400 |
|---|
| Density | 1.29g/cm3 | Boiling Point | 475.4ºC at 760mmHg |
|---|
| Molecular Formula | C18H21NO3 | Melting Point | 142-144ºC |
|---|
| MSDS | / | Flash Point | 241.3ºC |
|---|
Names
| Name | thebainone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.29g/cm3 |
|---|
| Boiling Point | 475.4ºC at 760mmHg |
|---|
| Melting Point | 142-144ºC |
|---|
| Molecular Formula | C18H21NO3 |
|---|
| Molecular Weight | 299.36400 |
|---|
| Flash Point | 241.3ºC |
|---|
| Exact Mass | 299.15200 |
|---|
| PSA | 49.77000 |
|---|
| LogP | 1.98190 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.641 |
|---|
| InChIKey | SLJDAVMWFVYEFI-IYOUNJFTSA-N |
|---|
| SMILES | COc1ccc2c(c1O)C13CCN(C)C(C2)C1C=CC(=O)C3 |
|---|
Synonyms
| 4-Hydroxy-3-methoxy-17-methyl-morphin-7-en-6-on |
| Thebainone a |
| 4-hydroxy-3-methoxy-17-methyl-morphin-7-en-6-one |
| 7,8-Didehydro-4-hydroxy-3-methoxy-17-methylmorphinan-6-one |
