Introduction：Basic information about CAS 41487-00-7|Z-Ile-Val-OH, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Z-Ile-Val-OH |
|---|
| CAS Number | 41487-00-7 | Molecular Weight | 364.43600 |
|---|
| Density | 1.145g/cm3 | Boiling Point | 590.1ºC at 760mmHg |
|---|
| Molecular Formula | C19H28N2O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 310.7ºC |
|---|
Names
| Name | 3-methyl-2-[[3-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]butanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.145g/cm3 |
|---|
| Boiling Point | 590.1ºC at 760mmHg |
|---|
| Molecular Formula | C19H28N2O5 |
|---|
| Molecular Weight | 364.43600 |
|---|
| Flash Point | 310.7ºC |
|---|
| Exact Mass | 364.20000 |
|---|
| PSA | 104.73000 |
|---|
| LogP | 3.33470 |
|---|
| Index of Refraction | 1.522 |
|---|
| InChIKey | XISNUVNLGJKNIK-UHFFFAOYSA-N |
|---|
| SMILES | CCC(C)C(NC(=O)OCc1ccccc1)C(=O)NC(C(=O)O)C(C)C |
|---|
Synonyms
| Z-Ile-Val-OH |
| EINECS 255-395-4 |
| N-Benzyloxycarbonyl-L-isoleucyl-L-valin |
