Introduction：Basic information about CAS 76542-83-1|Fmoc-L-Leu-OSu, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Fmoc-L-Leu-OSu |
|---|
| CAS Number | 76542-83-1 | Molecular Weight | 450.484 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C25H26N2O6 | Melting Point | 120-125 °C |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | (2,5-dioxopyrrolidin-1-yl) (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpentanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Melting Point | 120-125 °C |
|---|
| Molecular Formula | C25H26N2O6 |
|---|
| Molecular Weight | 450.484 |
|---|
| Exact Mass | 450.179077 |
|---|
| PSA | 102.01000 |
|---|
| LogP | 3.43 |
|---|
| Index of Refraction | 1.620 |
|---|
| InChIKey | QOQFIQIYPSPWHZ-NRFANRHFSA-N |
|---|
| SMILES | CC(C)CC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)ON1C(=O)CCC1=O |
|---|
Synonyms
| L-Leucine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-, 2,5-dioxo-1-pyrrolidinyl ester |
| AmbotzFAA6440 |
| 2,5-Dioxo-1-pyrrolidinyl N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-leucinate |
| Fmoc-Leu-OSu |
| Fmoc-L-leucine N-hydroxysuccinimide ester |
