Introduction：Basic information about CAS 28177-69-7|2-hydroxy-3-nitroacetophenone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-hydroxy-3-nitroacetophenone |
|---|
| CAS Number | 28177-69-7 | Molecular Weight | 181.14500 |
|---|
| Density | 1.38g/cm3 | Boiling Point | 223.5ºC at 760mmHg |
|---|
| Molecular Formula | C8H7NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 93.1ºC |
|---|
Names
| Name | 1-(2-hydroxy-3-nitrophenyl)ethanone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.38g/cm3 |
|---|
| Boiling Point | 223.5ºC at 760mmHg |
|---|
| Molecular Formula | C8H7NO4 |
|---|
| Molecular Weight | 181.14500 |
|---|
| Flash Point | 93.1ºC |
|---|
| Exact Mass | 181.03800 |
|---|
| PSA | 83.12000 |
|---|
| LogP | 2.02620 |
|---|
| Vapour Pressure | 0.0644mmHg at 25°C |
|---|
| Index of Refraction | 1.596 |
|---|
| InChIKey | XQZGSPSZLMKODN-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)c1cccc([N+](=O)[O-])c1O |
|---|
| Storage condition | 2-8°C |
|---|
Synonyms
| 2-Hydroxy-3-nitroacetophenone |
| 1-(2-hydroxy-3-nitro-phenyl)-ethanone |
| 1-(2-Hydroxy-3-nitro-phenyl)-aethanon |
| MFCD02683784 |
