Introduction：Basic information about CAS 27955-44-8|6-methyl-4-phenyl-1H-pyrimidine-2-thione, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-methyl-4-phenyl-1H-pyrimidine-2-thione |
|---|
| CAS Number | 27955-44-8 | Molecular Weight | 202.27500 |
|---|
| Density | 1.19g/cm3 | Boiling Point | 320.5ºC at 760mmHg |
|---|
| Molecular Formula | C11H10N2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 147.6ºC |
|---|
Names
| Name | 6-methyl-4-phenyl-1H-pyrimidine-2-thione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.19g/cm3 |
|---|
| Boiling Point | 320.5ºC at 760mmHg |
|---|
| Molecular Formula | C11H10N2S |
|---|
| Molecular Weight | 202.27500 |
|---|
| Flash Point | 147.6ºC |
|---|
| Exact Mass | 202.05600 |
|---|
| PSA | 64.58000 |
|---|
| LogP | 2.74070 |
|---|
| Vapour Pressure | 0.000317mmHg at 25°C |
|---|
| Index of Refraction | 1.642 |
|---|
| InChIKey | LWQVDRQQNNUJRO-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(-c2ccccc2)nc(=S)[nH]1 |
|---|
Synonyms
| 4-methyl-6-phenylpyrimidine-2-thiol |
| Pyrimidinthion |
| 2-mercapto-4-methyl-6-phenylpyrimidine |
