Introduction：Basic information about CAS 148005-22-5|2,8-Diazaspiro[5.5]undecane-1,3,7,9-tetrone, 2,8-bis(phenylmethyl), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,8-Diazaspiro[5.5]undecane-1,3,7,9-tetrone, 2,8-bis(phenylmethyl) |
|---|
| CAS Number | 148005-22-5 | Molecular Weight | 390.43200 |
|---|
| Density | 1.33g/cm3 | Boiling Point | 663.6ºC at 760 mmHg |
|---|
| Molecular Formula | C23H22N2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 316.8ºC |
|---|
Names
| Name | 2,8-Diazaspiro[5.5]undecane-1,3,7,9-tetrone, 2,8-bis(phenylmethyl) |
|---|
Chemical & Physical Properties
| Density | 1.33g/cm3 |
|---|
| Boiling Point | 663.6ºC at 760 mmHg |
|---|
| Molecular Formula | C23H22N2O4 |
|---|
| Molecular Weight | 390.43200 |
|---|
| Flash Point | 316.8ºC |
|---|
| Exact Mass | 390.15800 |
|---|
| PSA | 74.76000 |
|---|
| LogP | 2.54700 |
|---|
| Vapour Pressure | 1.76E-17mmHg at 25°C |
|---|
| Index of Refraction | 1.647 |
|---|
| InChIKey | IQEFLASPEVLDBI-UHFFFAOYSA-N |
|---|
| SMILES | O=C1CCC2(CCC(=O)N(Cc3ccccc3)C2=O)C(=O)N1Cc1ccccc1 |
|---|
