Introduction:Basic information about CAS 143806-82-0|2,8-Diazaspiro[5.5]undecane-1,7-dione, 2-(phenylmethyl)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,8-Diazaspiro[5.5]undecane-1,7-dione, 2-(phenylmethyl)- |
|---|
| CAS Number | 143806-82-0 | Molecular Weight | 272.34200 |
|---|
| Density | / | Boiling Point | 555.5ºC at 760 mmHg |
|---|
| Molecular Formula | C16H20N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 289.8ºC |
|---|
Names
| Name | 2,8-Diazaspiro[5.5]undecane-1,7-dione, 2-(phenylmethyl) |
|---|
Chemical & Physical Properties
| Boiling Point | 555.5ºC at 760 mmHg |
|---|
| Molecular Formula | C16H20N2O2 |
|---|
| Molecular Weight | 272.34200 |
|---|
| Flash Point | 289.8ºC |
|---|
| Exact Mass | 272.15200 |
|---|
| PSA | 49.41000 |
|---|
| LogP | 1.97210 |
|---|
| Vapour Pressure | 2.23E-12mmHg at 25°C |
|---|
| Index of Refraction | 1.597 |
|---|
| InChIKey | DAEUYKAFIZJHPW-UHFFFAOYSA-N |
|---|
| SMILES | O=C1NCCCC12CCCN(Cc1ccccc1)C2=O |
|---|