Introduction:Basic information about CAS 1044210-29-8|2'-CHLORO-6'-METHYL-[1,1'-BIPHENYL]-4-AMINE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2'-CHLORO-6'-METHYL-[1,1'-BIPHENYL]-4-AMINE |
|---|
| CAS Number | 1044210-29-8 | Molecular Weight | 217.69400 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C13H12ClN | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 4-(2-chloro-6-methylphenyl)aniline |
|---|
Chemical & Physical Properties
| Molecular Formula | C13H12ClN |
|---|
| Molecular Weight | 217.69400 |
|---|
| Exact Mass | 217.06600 |
|---|
| PSA | 26.02000 |
|---|
| LogP | 4.47880 |
|---|
| InChIKey | BCFOKAHAXOWGGE-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cccc(Cl)c1-c1ccc(N)cc1 |
|---|
Safety Information
Customs
| HS Code | 2921499090 |
|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|