Introduction:Basic information about CAS 2719-15-5|Acetamide,N-(2-methyl-4-nitrophenyl)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Acetamide,N-(2-methyl-4-nitrophenyl)- |
|---|
| CAS Number | 2719-15-5 | Molecular Weight | 194.18700 |
|---|
| Density | 1.289 g/cm3 | Boiling Point | 393.3ºC at 760 mmHg |
|---|
| Molecular Formula | C9H10N2O3 | Melting Point | 198-200ºC |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | N-(2-methyl-4-nitrophenyl)acetamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.289 g/cm3 |
|---|
| Boiling Point | 393.3ºC at 760 mmHg |
|---|
| Melting Point | 198-200ºC |
|---|
| Molecular Formula | C9H10N2O3 |
|---|
| Molecular Weight | 194.18700 |
|---|
| Exact Mass | 194.06900 |
|---|
| PSA | 74.92000 |
|---|
| LogP | 2.45780 |
|---|
| Vapour Pressure | 2.15E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.605 |
|---|
| InChIKey | JZEOVPGWIWSSAK-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)Nc1ccc([N+](=O)[O-])cc1C |
|---|
Safety Information
| Hazard Codes | Xn:Harmful; |
|---|
| Risk Phrases | R20/21/22 |
|---|
| Safety Phrases | S36/37 |
|---|
Synonyms
| 4-nitro-2-methylacetanilide |
| Acetyl-p-nitro-o-toluidine |
| 2-acetylamino-5-nitrotoluene |
| 2′-Methyl-4′-nitroacetanilide |
| o-Acetotoluidide,4'-nitro |
| 4-acetamino-3-methyl-nitrobenzene |
| 4'-NITRO-O-ACETOTOLUIDIDE |
| 2'-Methyl-4'-nitroacetanilide |
| MFCD00033896 |