Introduction：Basic information about CAS 1032-67-3|1H-Isoindole-1,3(2H)-dione,2-(2-oxo-2-phenylethyl)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1H-Isoindole-1,3(2H)-dione,2-(2-oxo-2-phenylethyl)- |
|---|
| CAS Number | 1032-67-3 | Molecular Weight | 265.26300 |
|---|
| Density | 1.329g/cm3 | Boiling Point | 444.9ºC at 760 mmHg |
|---|
| Molecular Formula | C16H11NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 208.6ºC |
|---|
Names
| Name | 2-phenacylisoindole-1,3-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.329g/cm3 |
|---|
| Boiling Point | 444.9ºC at 760 mmHg |
|---|
| Molecular Formula | C16H11NO3 |
|---|
| Molecular Weight | 265.26300 |
|---|
| Flash Point | 208.6ºC |
|---|
| Exact Mass | 265.07400 |
|---|
| PSA | 54.45000 |
|---|
| LogP | 2.10340 |
|---|
| Vapour Pressure | 4.13E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.64 |
|---|
| InChIKey | NJJQFZCOSJYBII-UHFFFAOYSA-N |
|---|
| SMILES | O=C(CN1C(=O)c2ccccc2C1=O)c1ccccc1 |
|---|
Safety Information
Customs
| HS Code | 2925190090 |
|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| N-(2-phenyl-2-oxoethyl)phthalimide |
| 2-(1-phenylethanone-2-yl)isoindoline-1,3-dione |
| 2,6-DICHLORO-4-TRIFLUOROMETHYLSULFANYL-PHENOL |
| 2-(2-oxo-2-phenylethyl)benzo[c]azoline-1,3-dione |
| 2-(2-oxo-2-phenylethyl)isoindoline-1,3-dione |
| 2-(2-oxo-2-phenylethyl)-1,3-isoindolinedione |
| 2-(2-oxo-2-phenyl-ethyl)-isoindole-1,3-dione |
