Introduction：Basic information about CAS 6628-34-8|Ethyl 2-methyl-3-indolylglyoxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ethyl 2-methyl-3-indolylglyoxylate |
|---|
| CAS Number | 6628-34-8 | Molecular Weight | 231.24700 |
|---|
| Density | 1.259g/cm3 | Boiling Point | 515.6ºC at 760 mmHg |
|---|
| Molecular Formula | C13H13NO3 | Melting Point | 129.5°C (lit.) |
|---|
| MSDS | / | Flash Point | 292.6ºC |
|---|
Names
| Name | ethyl 2-(2-methyl-1H-indol-3-yl)-2-oxoacetate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.259g/cm3 |
|---|
| Boiling Point | 515.6ºC at 760 mmHg |
|---|
| Melting Point | 129.5°C (lit.) |
|---|
| Molecular Formula | C13H13NO3 |
|---|
| Molecular Weight | 231.24700 |
|---|
| Flash Point | 292.6ºC |
|---|
| Exact Mass | 231.09000 |
|---|
| PSA | 59.16000 |
|---|
| LogP | 2.22210 |
|---|
| Index of Refraction | 1.589 |
|---|
| InChIKey | RDKVWTARRVILKC-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)C(=O)c1c(C)[nH]c2ccccc12 |
|---|
Safety Information
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| Propionic acid anion |
| (2-methyl-indol-3-yl)-oxo-acetic acid ethyl ester |
| (2-Methyl-indol-3-yl)-glyoxylsaeure-aethylester |
| ethyl 2-methylindol-3-ylglyoxylate |
| ethyl (2-methyl-1H-indol-3-yl)(oxo)acetate |
| (2-Methyl-indolyl-3)-glyoxylsaeure-ethylester |
| (2-methyl-indol-3-yl)-glyoxylic acid ethyl ester |
| 2-methylindole-3-ethylglyoxylate |
| Propanoic acid anion |
