CAS 37589-57-4|Dotetracontafluoroicosane
Introduction:Basic information about CAS 37589-57-4|Dotetracontafluoroicosane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Dotetracontafluoroicosane | ||
|---|---|---|---|
| CAS Number | 37589-57-4 | Molecular Weight | 1038.147 |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 323.8±10.0 °C at 760 mmHg |
| Molecular Formula | C20F42 | Melting Point | 164-166 °C(lit.) |
| MSDS | / | Flash Point | 144.8±10.8 °C |
Names
| Name | perfluoroeicosane |
|---|---|
| Synonym | More Synonyms |
Chemical & Physical Properties
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 323.8±10.0 °C at 760 mmHg |
| Melting Point | 164-166 °C(lit.) |
| Molecular Formula | C20F42 |
| Molecular Weight | 1038.147 |
| Flash Point | 144.8±10.8 °C |
| Exact Mass | 1037.932983 |
| LogP | 18.10 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.273 |
| InChIKey | WSXNCJNDCDTRSA-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| WGK Germany | 3 |
| HS Code | 2903399090 |
Customs
| HS Code | 2903399090 |
|---|---|
| Summary | 2903399090. brominated,fluorinated or iodinated derivatives of acyclic hydrocarbons. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
Synonyms
| Eicosane, 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,17,18,18,19,19,20,20,20-dotetracontafluoro- |
| Eicosane, dotetracontafluoro- |
| EINECS 253-557-9 |
| Perfluoroeicosane |
| Dotetracontafluoroicosane |
| MFCD00000438 |
| 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,17,18,18,19,19,20,20,20-dotetracontafluoroicosane |
