Introduction:Basic information about CAS 6628-94-0|6-(5,6-dimethyl-1,3-dihydrobenzoimidazol-2-ylidene)cyclohexa-2,4-dien-1-one, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-(5,6-dimethyl-1,3-dihydrobenzoimidazol-2-ylidene)cyclohexa-2,4-dien-1-one |
|---|
| CAS Number | 6628-94-0 | Molecular Weight | 238.28400 |
|---|
| Density | 1.419g/cm3 | Boiling Point | 617.5ºC at 760 mmHg |
|---|
| Molecular Formula | C15H14N2O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 327.3ºC |
|---|
Names
| Name | 1-[5-(2-carboxyethenyl)-2-methylphenyl]sulfonylpiperidine-4-carboxylic acid |
|---|
Chemical & Physical Properties
| Density | 1.419g/cm3 |
|---|
| Boiling Point | 617.5ºC at 760 mmHg |
|---|
| Molecular Formula | C15H14N2O |
|---|
| Molecular Weight | 238.28400 |
|---|
| Flash Point | 327.3ºC |
|---|
| Exact Mass | 238.11100 |
|---|
| PSA | 48.91000 |
|---|
| LogP | 3.55230 |
|---|
| Index of Refraction | 1.615 |
|---|
| InChIKey | NAYVWQJEVVYUAR-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc2nc(-c3ccccc3O)[nH]c2cc1C |
|---|