Introduction：Basic information about CAS 5574-24-3|oxoglaucine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | oxoglaucine |
|---|
| CAS Number | 5574-24-3 | Molecular Weight | 351.353 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 577.9±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C20H17NO5 | Melting Point | 227-229ºC (chloroform methanol ) |
|---|
| MSDS | / | Flash Point | 303.3±30.1 °C |
|---|
Names
| Name | Oxoglaucine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 577.9±50.0 °C at 760 mmHg |
|---|
| Melting Point | 227-229ºC (chloroform methanol ) |
|---|
| Molecular Formula | C20H17NO5 |
|---|
| Molecular Weight | 351.353 |
|---|
| Flash Point | 303.3±30.1 °C |
|---|
| Exact Mass | 351.110687 |
|---|
| PSA | 66.88000 |
|---|
| LogP | 3.44 |
|---|
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.640 |
|---|
| InChIKey | ZYKCETVKVRJFGD-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc2c(cc1OC)-c1c(OC)c(OC)cc3ccnc(c13)C2=O |
|---|
Synonyms
| 1,2,9,10-tetramethoxy-4-oxoaporphine |
| ATHEROLINE,O-METHYL |
| Noraporphin-7-one, 4,5,6,6a-tetradehydro-1,2,9,10-tetramethoxy- |
| 1,2,9,10-Tetramethoxy-7H-dibenzo[de,g]quinolin-7-one |
| O-Methylatheroline |
| 7H-Dibenzo(de,g)quinolin-7-one, 1,2,9,10-tetramethoxy- |
| 7H-Dibenzo[de,g]quinolin-7-one, 1,2,9,10-tetramethoxy- |
| oxoglaucine |
