Introduction:Basic information about CAS 5694-37-1|2-(3-carboxypropanoylamino)benzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(3-carboxypropanoylamino)benzoic acid |
|---|
| CAS Number | 5694-37-1 | Molecular Weight | 237.20900 |
|---|
| Density | 1.458g/cm3 | Boiling Point | 583.5ºC at 760 mmHg |
|---|
| Molecular Formula | C11H11NO5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 306.7ºC |
|---|
Names
| Name | N-(3-carboxypropanoyl)-L-phenylalanine-p-nitroanilide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.458g/cm3 |
|---|
| Boiling Point | 583.5ºC at 760 mmHg |
|---|
| Molecular Formula | C11H11NO5 |
|---|
| Molecular Weight | 237.20900 |
|---|
| Flash Point | 306.7ºC |
|---|
| Exact Mass | 237.06400 |
|---|
| PSA | 103.70000 |
|---|
| LogP | 1.26110 |
|---|
| Index of Refraction | 1.635 |
|---|
| InChIKey | OGPDRYVIHAFSNL-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)CCC(=O)Nc1ccccc1C(=O)O |
|---|
Safety Information
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| HS Code | 2924299090 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| N-(3-carboxypropionyl)-L-phenylalanine p-nitroanilide |
| N-(3-Carboxy-propionyl)-anthranilsaeure |
| N-(3-carboxy-propionyl)-anthranilic acid |
| Suphepa |
| N-Succinoylanthranilsaeure |
| 2-(3-carboxy-1-oxo-propylamino)-benzoic acid |
| o-carboxysuccinanilic acid |
| N-succinyl-L-phenylalanine p-nitroanilide |
| (S)-4-({2-[(4-nitrophenyl)amino]-2-oxo-1-(phenylmethyl)ethyl}amino)-4-oxobutyric acid |
| Suc-Phe-pNA |
| 4-({1-[(4-nitrophenyl)amino]-1-oxo-3-phenylpropan-2-yl}amino)-4-oxobutanoic acid |
| Succinanilsaeure-carbonsaeure-(2) |
| N-(2-Carboxy-phenyl)-succinamidsaeure |