Introduction：Basic information about CAS 20851-21-2|1H-Indole-3-methanamine,a-methyl-N-(1-methylethyl)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1H-Indole-3-methanamine,a-methyl-N-(1-methylethyl)- |
|---|
| CAS Number | 20851-21-2 | Molecular Weight | 202.29500 |
|---|
| Density | 1.041g/cm3 | Boiling Point | 332.3ºC at 760mmHg |
|---|
| Molecular Formula | C13H18N2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 154.7ºC |
|---|
Names
| Name | N-[1-(1H-indol-3-yl)ethyl]propan-2-amine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.041g/cm3 |
|---|
| Boiling Point | 332.3ºC at 760mmHg |
|---|
| Molecular Formula | C13H18N2 |
|---|
| Molecular Weight | 202.29500 |
|---|
| Flash Point | 154.7ºC |
|---|
| Exact Mass | 202.14700 |
|---|
| PSA | 27.82000 |
|---|
| LogP | 3.61780 |
|---|
| Vapour Pressure | 0.000148mmHg at 25°C |
|---|
| Index of Refraction | 1.59 |
|---|
| InChIKey | XQWQVJRSFNDGOD-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)NC(C)c1c[nH]c2ccccc12 |
|---|
Synonyms
| 3-(isopropylaminoethylidene)indole |
| (1-indol-3-yl-ethyl)-isopropyl-amine |
| N-[1-(1H-indol-3-yl)ethyl]-N-isopropyl-amine |
| N-[1-(1H-indol-3-yl)ethyl]-2-propanamine |
| 5-(isopropyl amino ethylidene)-indole |
| (1-Indol-3-yl-aethyl)-isopropyl-amin |
