Introduction：Basic information about CAS 34172-48-0|7-iodo-9H-fluoren-2-amine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 7-iodo-9H-fluoren-2-amine |
|---|
| CAS Number | 34172-48-0 | Molecular Weight | 307.13000 |
|---|
| Density | 1.778g/cm3 | Boiling Point | 455.7ºC at 760 mmHg |
|---|
| Molecular Formula | C13H10IN | Melting Point | / |
|---|
| MSDS | / | Flash Point | 229.4ºC |
|---|
Names
| Name | 7-iodo-9H-fluoren-2-amine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.778g/cm3 |
|---|
| Boiling Point | 455.7ºC at 760 mmHg |
|---|
| Molecular Formula | C13H10IN |
|---|
| Molecular Weight | 307.13000 |
|---|
| Flash Point | 229.4ºC |
|---|
| Exact Mass | 306.98600 |
|---|
| PSA | 26.02000 |
|---|
| LogP | 4.02580 |
|---|
| Index of Refraction | 1.758 |
|---|
| InChIKey | GVLJBTZWZXVFDV-UHFFFAOYSA-N |
|---|
| SMILES | Nc1ccc2c(c1)Cc1cc(I)ccc1-2 |
|---|
Synonyms
| 7-Jod-fluoren-amin-(2) |
| 7-Jod-fluoren-2-ylamin |
| 2-Amino-7-iod-fluoren |
| 7-iodo-9H-fluorene-2-amine |
| 7-iodo-fluoren-2-ylamine |
