Introduction：Basic information about CAS 6995-12-6|Fastigilin C, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Fastigilin C |
|---|
| CAS Number | 6995-12-6 | Molecular Weight | 360.40100 |
|---|
| Density | 1.25g/cm3 | Boiling Point | 545.9ºC at 760 mmHg |
|---|
| Molecular Formula | C20H24O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 192.5ºC |
|---|
Names
| Name | Fastigilin C |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.25g/cm3 |
|---|
| Boiling Point | 545.9ºC at 760 mmHg |
|---|
| Molecular Formula | C20H24O6 |
|---|
| Molecular Weight | 360.40100 |
|---|
| Flash Point | 192.5ºC |
|---|
| Exact Mass | 360.15700 |
|---|
| PSA | 89.90000 |
|---|
| LogP | 1.73420 |
|---|
| Index of Refraction | 1.56 |
|---|
| InChIKey | QQEQKSVDPDNRRR-NUYZTHSYSA-N |
|---|
| SMILES | C=C1C(=O)OC2C(O)C(C)C3C=CC(=O)C3(C)C(OC(=O)C=C(C)C)C12 |
|---|
Synonyms
| 8-Azabicyclo(3.2.1)octane-2,7-diol,(exo,exo)-(-) |
| 2,7-Dihydroxynortropane |
| (Exo,exo)-(-)-8-azabicyclo(3.2.1)octane-2,7-diol |
| (-)-erycibelline |
| (-)-fastigilin C |
| 8-azabicyclo[3.2.1]octane-2,7-diol |
