Introduction：Basic information about CAS 41447-19-2|Benzene,1-bromo-2-methoxy-5-methyl-4-nitro-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzene,1-bromo-2-methoxy-5-methyl-4-nitro- |
|---|
| CAS Number | 41447-19-2 | Molecular Weight | 246.05800 |
|---|
| Density | 1.559g/cm3 | Boiling Point | 314.6ºC at 760mmHg |
|---|
| Molecular Formula | C8H8BrNO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 144ºC |
|---|
Names
| Name | 1-bromo-2-methoxy-5-methyl-4-nitrobenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.559g/cm3 |
|---|
| Boiling Point | 314.6ºC at 760mmHg |
|---|
| Molecular Formula | C8H8BrNO3 |
|---|
| Molecular Weight | 246.05800 |
|---|
| Flash Point | 144ºC |
|---|
| Exact Mass | 244.96900 |
|---|
| PSA | 55.05000 |
|---|
| LogP | 3.19750 |
|---|
| Index of Refraction | 1.573 |
|---|
| InChIKey | JZBCPWGVPOVHAC-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc([N+](=O)[O-])c(C)cc1Br |
|---|
Synonyms
| 5-Brom-2-nitro-4-methoxy-toluol |
| 2-Bromo-4-methoxy-6-nitrotoluol |
| 3-Brom-4-methoxy-6-nitrotoluol |
| 2-Brom-4-methyl-5-nitro-anisol |
| 2-bromo-4-methyl-5-nitro-anisole |
| 3-bromo-4-methoxy-6-nitrotoluene |
| Methyl-(6-brom-3-nitro-4-methyl-phenyl)-aether |
