Introduction：Basic information about CAS 2943-42-2|4-Methylbenzenesulfonothioic acid S-(4-methylphenyl) ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Methylbenzenesulfonothioic acid S-(4-methylphenyl) ester |
|---|
| CAS Number | 2943-42-2 | Molecular Weight | 278.39000 |
|---|
| Density | 1.28g/cm3 | Boiling Point | 432.5ºC at 760mmHg |
|---|
| Molecular Formula | C14H14O2S2 | Melting Point | 75-77ºC |
|---|
| MSDS | / | Flash Point | 215.4ºC |
|---|
Names
| Name | S-p-Tolyl p-toluenethiolsulfonate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.28g/cm3 |
|---|
| Boiling Point | 432.5ºC at 760mmHg |
|---|
| Melting Point | 75-77ºC |
|---|
| Molecular Formula | C14H14O2S2 |
|---|
| Molecular Weight | 278.39000 |
|---|
| Flash Point | 215.4ºC |
|---|
| Exact Mass | 278.04400 |
|---|
| PSA | 67.82000 |
|---|
| LogP | 4.86520 |
|---|
| Vapour Pressure | 2.78E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.637 |
|---|
| InChIKey | HSAROCRPZOYKGS-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(SS(=O)(=O)c2ccc(C)cc2)cc1 |
|---|
Safety Information
Customs
| HS Code | 2930909090 |
|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| p-Toluenesulfonothioic acid S-p-tolyl ester |
| S-p-tolyl 4-methylbenzenesulfonothioate |
| p-Tolyl p-toluenethiolsulfonate |
| p-Toluenethiosulfonic acid S-p-tolyl ester |
| p-Tolyl p-toluenethiosulfonate |
| p-TolSO2S-p-Tol |
| 4-methylphenyl-4-methyl-benzenethiosulfonate |
| toluene-4-thiosulfonic acid S-p-tolyl ester |
