Introduction：Basic information about CAS 50823-86-4|1H-Carbazole,2,3,4,9-tetrahydro-6-nitro-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1H-Carbazole,2,3,4,9-tetrahydro-6-nitro- |
|---|
| CAS Number | 50823-86-4 | Molecular Weight | 216.23600 |
|---|
| Density | 1.346g/cm3 | Boiling Point | 413.5ºC at 760mmHg |
|---|
| Molecular Formula | C12H12N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 203.9ºC |
|---|
Names
| Name | 6-nitro-2,3,4,9-tetrahydro-1H-carbazole |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.346g/cm3 |
|---|
| Boiling Point | 413.5ºC at 760mmHg |
|---|
| Molecular Formula | C12H12N2O2 |
|---|
| Molecular Weight | 216.23600 |
|---|
| Flash Point | 203.9ºC |
|---|
| Exact Mass | 216.09000 |
|---|
| PSA | 61.61000 |
|---|
| LogP | 3.47810 |
|---|
| Index of Refraction | 1.697 |
|---|
| InChIKey | IROFVXNXPDWNEU-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1ccc2[nH]c3c(c2c1)CCCC3 |
|---|
Synonyms
| 6-nitro-1,2,3,4-tetrahydrocarbazole |
| 6-nitrotetrahydrocarbazole |
| 3-nitro-5,6,7,8,9-pentahydro-4aH-carbazole |
| 6-Nitro-1,2,3,4-tetrahydro-carbazol |
| 3-nitro-5,6,7,8-tetrahydro-9H-carbazole |
| 1h-carbazole,2,3,4,9-tetrahydro-6-nitro |
