Introduction:Basic information about CAS 6038-60-4|3-amino-4-methoxy-9-phenyl-5,8,10-trioxabicyclo[4.4.0]decan-2-ol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-amino-4-methoxy-9-phenyl-5,8,10-trioxabicyclo[4.4.0]decan-2-ol |
|---|
| CAS Number | 6038-60-4 | Molecular Weight | 281.30400 |
|---|
| Density | 1.31g/cm3 | Boiling Point | 465.7ºC at 760 mmHg |
|---|
| Molecular Formula | C14H19NO5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 235.4ºC |
|---|
Names
| Name | 7-amino-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol |
|---|
Chemical & Physical Properties
| Density | 1.31g/cm3 |
|---|
| Boiling Point | 465.7ºC at 760 mmHg |
|---|
| Molecular Formula | C14H19NO5 |
|---|
| Molecular Weight | 281.30400 |
|---|
| Flash Point | 235.4ºC |
|---|
| Exact Mass | 281.12600 |
|---|
| PSA | 83.17000 |
|---|
| LogP | 0.86040 |
|---|
| Index of Refraction | 1.586 |
|---|
| InChIKey | GQJOKDVZCWTBHR-UHFFFAOYSA-N |
|---|
| SMILES | COC1OC2COC(c3ccccc3)OC2C(O)C1N |
|---|