Introduction：Basic information about CAS 5028-23-9|N,N-Dimethyl-3-nitropyridin-2-amine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N,N-Dimethyl-3-nitropyridin-2-amine |
|---|
| CAS Number | 5028-23-9 | Molecular Weight | 167.16500 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C7H9N3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | N,N-Dimethyl-3-nitropyridin-2-amine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C7H9N3O2 |
|---|
| Molecular Weight | 167.16500 |
|---|
| Exact Mass | 167.06900 |
|---|
| PSA | 61.95000 |
|---|
| LogP | 1.57900 |
|---|
| InChIKey | HOESCRDIWBIVCL-UHFFFAOYSA-N |
|---|
| SMILES | CN(C)c1ncccc1[N+](=O)[O-] |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H302 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| HS Code | 2933399090 |
|---|
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| HOESCRDIWBIVCL-UHFFFAOYSA |
| 2-Pyridinamine,N,N-dimethyl-3-nitro |
| 2-(Dimethylamino)-3-nitropyridine |
| 2-(N-Dimethylamino)-3-nitro-pyridin |
| 2-Dimethylamino-3-nitropyridin |
| dimethyl-(3-nitro-pyridin-2-yl)-amine |
| Dimethyl-(3-nitro-[2]pyridyl)-amin |
| N,N-Dimethyl-3-nitro-2-pyridinamine |
