Introduction：Basic information about CAS 886498-98-2|2,6-Difluoro-4-methoxyphenylacetic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,6-Difluoro-4-methoxyphenylacetic acid |
|---|
| CAS Number | 886498-98-2 | Molecular Weight | 202.155 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 269.4±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H8F2O3 | Melting Point | 138-141°C |
|---|
| MSDS | / | Flash Point | 116.7±25.9 °C |
|---|
Names
| Name | 2,6-Difluoro-4-methoxyphenylacetic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 269.4±35.0 °C at 760 mmHg |
|---|
| Melting Point | 138-141°C |
|---|
| Molecular Formula | C9H8F2O3 |
|---|
| Molecular Weight | 202.155 |
|---|
| Flash Point | 116.7±25.9 °C |
|---|
| Exact Mass | 202.044144 |
|---|
| PSA | 46.53000 |
|---|
| LogP | 1.66 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.502 |
|---|
| InChIKey | KXWRAINJKJTUDG-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc(F)c(CC(=O)O)c(F)c1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2918990090 |
|---|
Customs
| HS Code | 2918990090 |
|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 2,6-Difluoro-4-methoxybenzeneacetic acid |
| QV1R BF FF DO1 |
| (2,6-Difluoro-4-methoxyphenyl)acetic acid |
| 2-(2,6-Difluoro-4-methoxyphenyl)acetic acid |
| Benzeneacetic acid, 2,6-difluoro-4-methoxy- |
| 2,6-Difluoro-4-methoxyphenylacetic acid |
