Introduction：Basic information about CAS 201217-86-9|Boc-D-Thr(tBu)-OH, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Boc-D-Thr(tBu)-OH |
|---|
| CAS Number | 201217-86-9 | Molecular Weight | 275.341 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 391.3±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H25NO5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 190.4±26.5 °C |
|---|
Names
| Name | (2R,3S)-3-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 391.3±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H25NO5 |
|---|
| Molecular Weight | 275.341 |
|---|
| Flash Point | 190.4±26.5 °C |
|---|
| Exact Mass | 275.173279 |
|---|
| PSA | 84.86000 |
|---|
| LogP | 3.00 |
|---|
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.463 |
|---|
| InChIKey | LKRXXARJBFBMCE-DTWKUNHWSA-N |
|---|
| SMILES | CC(OC(C)(C)C)C(NC(=O)OC(C)(C)C)C(=O)O |
|---|
Synonyms
| Boc-D-Thr(tBu)-OH |
| O-(2-Methyl-2-propanyl)-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-D-threonine |
| D-Threonine, N-[(1,1-dimethylethoxy)carbonyl]-O-(1,1-dimethylethyl)- |
| Boc-O-tert-butyl-D-threonine |
