Introduction：Basic information about CAS 4192-28-3|pht-ala-oh, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | pht-ala-oh |
|---|
| CAS Number | 4192-28-3 | Molecular Weight | 219.193 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 407.9±28.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H9NO4 | Melting Point | 139 - 141ºC |
|---|
| MSDS | USA | Flash Point | 200.5±24.0 °C |
|---|
Names
| Name | (2S)-2-(1,3-dioxoisoindol-2-yl)propanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 407.9±28.0 °C at 760 mmHg |
|---|
| Melting Point | 139 - 141ºC |
|---|
| Molecular Formula | C11H9NO4 |
|---|
| Molecular Weight | 219.193 |
|---|
| Flash Point | 200.5±24.0 °C |
|---|
| Exact Mass | 219.053162 |
|---|
| PSA | 74.68000 |
|---|
| LogP | 1.54 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.629 |
|---|
| InChIKey | OZWUITKBAWTEAQ-LURJTMIESA-N |
|---|
| SMILES | CC(C(=O)O)N1C(=O)c2ccccc2C1=O |
|---|
| Storage condition | Store at 0°C |
|---|
Safety Information
| Hazard Codes | T |
|---|
| Risk Phrases | 25 |
|---|
| Safety Phrases | 45 |
|---|
Synonyms
| N-Phth-Ala-OH |
| OZWUITKBAWTEAQ-UHFFFAOYSA |
| N-Pht-L-Ala |
| Phthaloyl-L-alanine |
| PHT-ALA-OH |
| N-phthaloylalanine |
| (2S)-2-(1,3-Dioxo-1,3-dihydro-2H-isoindol-2-yl)propanoic acid |
| N-phthaloyl-L-alanine |
| 2-(1,3-Dioxo-1,3-dihydro-2H-isoindol-2-yl)propanoic acid |
| 2H-Isoindole-2-acetic acid, 1,3-dihydro-α-methyl-1,3-dioxo- |
| 2H-Isoindole-2-acetic acid, 1,3-dihydro-α-methyl-1,3-dioxo-, (αS)- |
| PhtN-L-Ala-OH |
