Introduction：Basic information about CAS 434957-82-1|Methyl (S)-3-acetamido-3-(4-methoxyphenyl)propanoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methyl (S)-3-acetamido-3-(4-methoxyphenyl)propanoate |
|---|
| CAS Number | 434957-82-1 | Molecular Weight | 251.27800 |
|---|
| Density | 1.129 g/cm3 | Boiling Point | 440.3ºC at 760 mmHg |
|---|
| Molecular Formula | C13H17NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 220.1ºC |
|---|
Names
| Name | Methyl (S)-3-acetamido-3-(4-methoxyphenyl)propanoate |
|---|
Chemical & Physical Properties
| Density | 1.129 g/cm3 |
|---|
| Boiling Point | 440.3ºC at 760 mmHg |
|---|
| Molecular Formula | C13H17NO4 |
|---|
| Molecular Weight | 251.27800 |
|---|
| Flash Point | 220.1ºC |
|---|
| Exact Mass | 251.11600 |
|---|
| PSA | 64.63000 |
|---|
| LogP | 1.82640 |
|---|
| Index of Refraction | 1.508 |
|---|
| InChIKey | HPOHGSFWIOTIFP-LBPRGKRZSA-N |
|---|
| SMILES | COC(=O)CC(NC(C)=O)c1ccc(OC)cc1 |
|---|
