Introduction：Basic information about CAS 46249-41-6|4-Sulfamoylbenzene-1-sulfonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Sulfamoylbenzene-1-sulfonyl chloride |
|---|
| CAS Number | 46249-41-6 | Molecular Weight | 255.69900 |
|---|
| Density | 1.649g/cm3 | Boiling Point | 433.957ºC at 760 mmHg |
|---|
| Molecular Formula | C6H6ClNO4S2 | Melting Point | / |
|---|
| MSDS | USA | Flash Point | 216.25ºC |
|---|
Names
| Name | 4-sulfamoylbenzenesulfonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.649g/cm3 |
|---|
| Boiling Point | 433.957ºC at 760 mmHg |
|---|
| Molecular Formula | C6H6ClNO4S2 |
|---|
| Molecular Weight | 255.69900 |
|---|
| Flash Point | 216.25ºC |
|---|
| Exact Mass | 254.94300 |
|---|
| PSA | 111.06000 |
|---|
| LogP | 3.12340 |
|---|
| Index of Refraction | 1.597 |
|---|
| InChIKey | LLFQHNCOIPUFIJ-UHFFFAOYSA-N |
|---|
| SMILES | NS(=O)(=O)c1ccc(S(=O)(=O)Cl)cc1 |
|---|
Safety Information
Customs
| HS Code | 2935009090 |
|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|---|
Synonyms
| 4-sulfamoylbenzenesulphonyl chloride |
| F3351-0215 |
| 4-sulfamoyl-benzenesulfonyl chloride |
| 4-Sulfamoyl-benzolsulfonylchlorid |
