Introduction：Basic information about CAS 4655-44-1|N-(4-bromophenyl)sulfonylbenzenecarboximidoyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-(4-bromophenyl)sulfonylbenzenecarboximidoyl chloride |
|---|
| CAS Number | 4655-44-1 | Molecular Weight | 358.63800 |
|---|
| Density | 1.54g/cm3 | Boiling Point | 463ºC at 760mmHg |
|---|
| Molecular Formula | C13H9BrClNO2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 233.8ºC |
|---|
Names
| Name | N-(4-bromophenyl)sulfonylbenzenecarboximidoyl chloride |
|---|
Chemical & Physical Properties
| Density | 1.54g/cm3 |
|---|
| Boiling Point | 463ºC at 760mmHg |
|---|
| Molecular Formula | C13H9BrClNO2S |
|---|
| Molecular Weight | 358.63800 |
|---|
| Flash Point | 233.8ºC |
|---|
| Exact Mass | 356.92300 |
|---|
| PSA | 54.88000 |
|---|
| LogP | 4.90420 |
|---|
| Index of Refraction | 1.629 |
|---|
| InChIKey | CFRCKJJVYIMSFW-SSZFMOIBSA-N |
|---|
| SMILES | O=S(=O)(N=C(Cl)c1ccccc1)c1ccc(Br)cc1 |
|---|
Safety Information
Customs
| HS Code | 2925290090 |
|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
