Introduction:Basic information about CAS 46765-03-1|4,4'-sulfonyldiphenol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4,4'-sulfonyldiphenol |
|---|
| CAS Number | 46765-03-1 | Molecular Weight | 250.27000 |
|---|
| Density | 1.432 g/cm3 | Boiling Point | 533ºC at 760 mmHg |
|---|
| Molecular Formula | C12H10O4S | Melting Point | 245-250ºC(lit.) |
|---|
| MSDS | / | Flash Point | 276.2ºC |
|---|
Names
| Name | 3-(3-hydroxyphenyl)sulfonylphenol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.432 g/cm3 |
|---|
| Boiling Point | 533ºC at 760 mmHg |
|---|
| Melting Point | 245-250ºC(lit.) |
|---|
| Molecular Formula | C12H10O4S |
|---|
| Molecular Weight | 250.27000 |
|---|
| Flash Point | 276.2ºC |
|---|
| Exact Mass | 250.03000 |
|---|
| PSA | 82.98000 |
|---|
| LogP | 3.01140 |
|---|
| Index of Refraction | 1.645 |
|---|
| InChIKey | OQYYLPLRBBDFLA-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)(c1cccc(O)c1)c1cccc(O)c1 |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36 |
|---|
| Safety Phrases | 26 |
|---|
| WGK Germany | 2 |
|---|
| RTECS | SM8925000 |
|---|
Synonyms
| MFCD00002350 |
| 3.3'-Dioxy-diphenylsulfon |
| EINECS 201-250-5 |
| m,m'-sulfonylbisphenol |
| 3,3'-Sulfonyl-di-phenol |
| Phenol,3,3'-sulfonylbis |
| 3,3'-Dihydroxy diphenyl sulfone |
| 3,3'-sulfonylbis-phenol |