Introduction：Basic information about CAS 17738-86-2|ethyl 2-oxo-2-[3-(trifluoromethyl)anilino]acetate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | ethyl 2-oxo-2-[3-(trifluoromethyl)anilino]acetate |
|---|
| CAS Number | 17738-86-2 | Molecular Weight | 261.19700 |
|---|
| Density | 1.356g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C11H10F3NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | ethyl 2-oxo-2-[3-(trifluoromethyl)anilino]acetate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.356g/cm3 |
|---|
| Molecular Formula | C11H10F3NO3 |
|---|
| Molecular Weight | 261.19700 |
|---|
| Exact Mass | 261.06100 |
|---|
| PSA | 55.40000 |
|---|
| LogP | 2.28000 |
|---|
| Index of Refraction | 1.499 |
|---|
| InChIKey | UKPJCBWVGQNZSF-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)C(=O)Nc1cccc(C(F)(F)F)c1 |
|---|
Synonyms
| 3'-Trifluoromethyloxanilic acid ethyl ester |
| ethyl 3'-(trifluoromethyl)oxanilate |
| ethyl 2-oxo-2-(3-trifluoromethylphenylamino)acetate |
| ethyl oxo{[3-(trifluoromethyl)phenyl]amino}acetate |
