Introduction:Basic information about CAS 7454-54-8|4-Bromo-N-phenylbenzenesulfonamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Bromo-N-phenylbenzenesulfonamide |
|---|
| CAS Number | 7454-54-8 | Molecular Weight | 312.18200 |
|---|
| Density | 1.603g/cm3 | Boiling Point | 420.8ºC at 760 mmHg |
|---|
| Molecular Formula | C12H10BrNO2S | Melting Point | 116-117 °C |
|---|
| MSDS | / | Flash Point | 208.3ºC |
|---|
Names
| Name | 4-Bromo-N-phenylbenzenesulfonamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.603g/cm3 |
|---|
| Boiling Point | 420.8ºC at 760 mmHg |
|---|
| Melting Point | 116-117 °C |
|---|
| Molecular Formula | C12H10BrNO2S |
|---|
| Molecular Weight | 312.18200 |
|---|
| Flash Point | 208.3ºC |
|---|
| Exact Mass | 310.96200 |
|---|
| PSA | 54.55000 |
|---|
| LogP | 4.40370 |
|---|
| Index of Refraction | 1.657 |
|---|
| InChIKey | ZCUJCYISOKHAAW-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)(Nc1ccccc1)c1ccc(Br)cc1 |
|---|
Synonyms
| 4-Brom-benzolsulfonsaeure-anilid |
| 4-bromo-N-phenyl-benzenesulfonamide |
| 4-bromo-benzenesulfonic acid anilide |
| N-brosylaniline |
| p-bromobenzenesulphonanilide |
| N-phenyl p-bromobenzenesulfonamide |