Introduction：Basic information about CAS 107754-20-1|4-[[5-[[cyclopentyloxy)carbonyl]amino]-1-methylindol-3-yl]methyl]-3-methoxybe, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-[[5-[[cyclopentyloxy)carbonyl]amino]-1-methylindol-3-yl]methyl]-3-methoxybenzoic acid |
|---|
| CAS Number | 107754-20-1 | Molecular Weight | 422.47400 |
|---|
| Density | 1.3g/cm3 | Boiling Point | 601.4ºC at 760 mmHg |
|---|
| Molecular Formula | C24H26N2O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 317.5ºC |
|---|
Names
| Name | 4-[[5-(cyclopentyloxycarbonylamino)-1-methylindol-3-yl]methyl]-3-methoxybenzoic acid |
|---|
Chemical & Physical Properties
| Density | 1.3g/cm3 |
|---|
| Boiling Point | 601.4ºC at 760 mmHg |
|---|
| Molecular Formula | C24H26N2O5 |
|---|
| Molecular Weight | 422.47400 |
|---|
| Flash Point | 317.5ºC |
|---|
| Exact Mass | 422.18400 |
|---|
| PSA | 93.28000 |
|---|
| LogP | 4.98060 |
|---|
| Vapour Pressure | 2.58E-15mmHg at 25°C |
|---|
| Index of Refraction | 1.629 |
|---|
| InChIKey | KFQBKNCZRCRBOU-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc(C(=O)O)ccc1Cc1cn(C)c2ccc(NC(=O)OC3CCCC3)cc12 |
|---|
