Introduction:Basic information about CAS 27106-51-0|1-(toluene-4-sulfonyl)-piperazine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-(toluene-4-sulfonyl)-piperazine |
|---|
| CAS Number | 27106-51-0 | Molecular Weight | 240.32200 |
|---|
| Density | / | Boiling Point | 387.4ºC at 760mmHg |
|---|
| Molecular Formula | C11H16N2O2S | Melting Point | 97-100ºC |
|---|
| MSDS | / | Flash Point | 188.1ºC |
|---|
Names
| Name | 1-(4-methylphenyl)sulfonylpiperazine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 387.4ºC at 760mmHg |
|---|
| Melting Point | 97-100ºC |
|---|
| Molecular Formula | C11H16N2O2S |
|---|
| Molecular Weight | 240.32200 |
|---|
| Flash Point | 188.1ºC |
|---|
| Exact Mass | 240.09300 |
|---|
| PSA | 57.79000 |
|---|
| LogP | 1.93640 |
|---|
| Vapour Pressure | 3.31E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.565 |
|---|
| InChIKey | VHFDYFUMWJSVCA-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(S(=O)(=O)N2CCNCC2)cc1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2933599090 |
|---|
Customs
| HS Code | 2933599090 |
|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 1-(p-toluenesulfonyl)piperazine |
| 1-Tosylpiperazine |
| N-(p-toluenesulfonyl)piperazine |
| 1-(toluene-4-sulfonyl)-piperazine |
| 1-(p-tosyl)piperazine |
| 1-[(4-methylphenyl)sulfonyl]piperazine |
| tosylpiperazine |
| [(4-methylphenyl)sulfonyl]piperazine |
| MFCD02018961 |
| p-toluenesulfonylpiperazine |