Introduction:Basic information about CAS 89943-82-8|Cicletanine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Cicletanine |
|---|
| CAS Number | 89943-82-8 | Molecular Weight | 261.70400 |
|---|
| Density | 1.351g/cm3 | Boiling Point | 446.3ºC at 760 mmHg |
|---|
| Molecular Formula | C14H12ClNO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 223.7ºC |
|---|
Names
| Name | 3-(4-Chlorophenyl)-6-methyl-1,3-dihydrofuro[3,4-c]pyridin-7-ol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.351g/cm3 |
|---|
| Boiling Point | 446.3ºC at 760 mmHg |
|---|
| Molecular Formula | C14H12ClNO2 |
|---|
| Molecular Weight | 261.70400 |
|---|
| Flash Point | 223.7ºC |
|---|
| Exact Mass | 261.05600 |
|---|
| PSA | 42.35000 |
|---|
| LogP | 3.36860 |
|---|
| Index of Refraction | 1.637 |
|---|
| InChIKey | CVKNDPRBJVBDSS-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ncc2c(c1O)COC2c1ccc(Cl)cc1 |
|---|
Synonyms
| Chicoric acid,meso form |
| (+/-)-3-(4-chlorophenyl)-1,3-dihydro-6-methylfuro-[3,4-c]pyridin-7-ol |
| (-)-1,3-dihydro-6-methyl-3-p-chlorophenyl-7-hydroxy-furo[3,4-c]pyridine |
| cicletanide |
| (-)-3-(4-chlorophenyl)-1,3-dihydro-7-hydroxy-6-methylfuro-[3,4-c]pyridine |
| Cicletanine |
| (2S,1R)-1,2-Bis[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]ethane-1,2-dicarboxylic acid |
| Chicoric acid |
| meso-DCTA |
| (-)-2,3-bis{[3-(3,4-dihydroxyphenyl)-1-oxoprop-2-enyl]oxy}butanedioic acid |
| Butanedioic acid,2,3-bis((3-(3,4-dihydroxyphenyl)-1-oxo-2-propenyl)oxy)-,(R*,S*-(E,E)) |
| Dicaffeoyltartaric acid,meso form |